On Target CAPSD_HCV77 0.45112783/CHEMBL3645608
For the given ligand Narlaprevir, we have found in our database that, being scored 0.45112783, the most similar ligand is CHEMBL3645608. Check out the elaboration below.
| Narlaprevir (Given Ligand) | CHEMBL3645608 (Similar Ligand) |
|---|---|
| CCCCC(NC(=O)C1[C@@H]3[C@H](CN1C(=O)C(NC(=O)NC2(CS(=O)(=O)C(C)(C)C)CCCCC2)C(C)(C)C)C3(C)C)C(=O)C(=O)NC4CC4 | CC[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]1CCCCN1C(C)C)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00010000 45003400 20100000 04100c00 00000000 00000090 00000004 20002008 04220000 020241a0 00202000 50033000 0e01b01e 01042101 c0000000 00000000 04000010 00020001 02002050 00000301 40000100 300d0631 00000303 0a3c0018 00011000 00000000 00004000 10000020 08000000 00040031 200a4000 03012220 | 000100a0 01003000 06100000 05200400 00000000 00000010 00020000 20001008 00000000 0000c180 00602000 50013000 0601801a 01002011 a0400000 00000000 04000000 00000000 06002000 00004201 00000000 30040630 00000003 32900038 00000000 00000000 00000000 10000010 08000000 40040001 60024004 00012260 |