On Target NA_A-H3N8 0.26760563/CHEMBL674
For the given ligand Boceprevir, we have found in our database that, being scored 0.26760563, the most similar ligand is CHEMBL674. Check out the elaboration below.
| Boceprevir (Given Ligand) | CHEMBL674 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)N[C@H](C(=O)N1C[C@H]3[C@@H]([C@H]1C(=O)NC(CC2CCC2)C(=O)C(N)=O)C3(C)C)C(C)(C)C | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00010000 01003400 00100000 04000c00 00000000 00000010 00000004 20002008 04000000 00020180 00200000 50013000 0e00b01a 01002011 80000000 00000000 00000010 00000001 00002050 00000201 00000100 300d0630 00000003 02100018 00011000 00000000 00000000 10000000 08000000 00040011 20024000 00002200 | 00070040 09007000 00100000 80010500 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a04000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04000 90000001 0c000200 00040401 04020000 00000210 |