On Target GP_EBOV 0.3764706/CHEMBL1655
For the given ligand Resvertrol, we have found in our database that, being scored 0.3764706, the most similar ligand is CHEMBL1655. Check out the elaboration below.
| Resvertrol (Given Ligand) | CHEMBL1655 (Similar Ligand) |
|---|---|
| Oc2ccc(/C=C/c1cc(O)cc(O)c1)cc2 | CN(C)CCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
|
|
|
|
|
|
| 00000001 40000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00000840 00000100 40108000 00000002 00000000 00000002 00000008 00000400 02000000 00000000 00020a00 00000000 18000000 00000001 00400000 00000000 80000000 00422000 40000000 00400000 00020100 04000000 00000000 | 04022000 00000008 20000308 00010602 00001080 00000000 82040080 01008400 00000800 00180840 08300500 40018000 00800002 00000000 01001003 00080008 00000400 02000000 00000000 00020001 00000100 18040100 12008081 00400010 01000000 a8000000 00522000 40000008 00400280 00060002 04000000 00820600 |