On Target NA_A-H3N8 0.16129032/CHEMBL4292576
For the given ligand Resvertrol, we have found in our database that, being scored 0.16129032, the most similar ligand is CHEMBL4292576. Check out the elaboration below.
| Resvertrol (Given Ligand) | CHEMBL4292576 (Similar Ligand) |
|---|---|
| Oc2ccc(/C=C/c1cc(O)cc(O)c1)cc2 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(OC)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000001 40000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00000840 00000100 40108000 00000002 00000000 00000002 00000008 00000400 02000000 00000000 00020a00 00000000 18000000 00000001 00400000 00000000 80000000 00422000 40000000 00400000 00020100 04000000 00000000 | 00070040 09007008 20100108 84010700 00181080 00000800 020c0180 3a00140a 11000000 001108c8 40200000 41019001 0402881a 01882000 01001409 00081008 10a04000 02000060 60c12010 00020201 00000020 38048e80 13008080 02500018 10001401 c0001400 00e24000 90000001 0c000300 00060401 24060000 00800a10 |