On Target NP_HCoV-OC43 0.07368421/CHEMBL3233481
For the given ligand Resvertrol, we have found in our database that, being scored 0.07368421, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Resvertrol (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Oc2ccc(/C=C/c1cc(O)cc(O)c1)cc2 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000001 40000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00000840 00000100 40108000 00000002 00000000 00000002 00000008 00000400 02000000 00000000 00020a00 00000000 18000000 00000001 00400000 00000000 80000000 00422000 40000000 00400000 00020100 04000000 00000000 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |