On Target NSP1_SARS 0.23728813/CHEMBL471187
For the given ligand Resvertrol, we have found in our database that, being scored 0.23728813, the most similar ligand is CHEMBL471187. Check out the elaboration below.
| Resvertrol (Given Ligand) | CHEMBL471187 (Similar Ligand) |
|---|---|
| Oc2ccc(/C=C/c1cc(O)cc(O)c1)cc2 | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(O)cc(O)cc2O3)c1 |
|
|
|
|
|
|
| 00000001 40000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00000840 00000100 40108000 00000002 00000000 00000002 00000008 00000400 02000000 00000000 00020a00 00000000 18000000 00000001 00400000 00000000 80000000 00422000 40000000 00400000 00020100 04000000 00000000 | 00000001 00000008 20000008 00000200 00001000 00000000 42000000 00000000 00100000 00000840 00000000 00008800 00004002 00000000 01000001 00008008 00000000 00000004 00002000 00020800 00400000 08000100 00000000 00000000 00000000 20000000 00080000 00200000 80000200 00020008 00000400 02000000 |