On Target PR_FCoV 0.109375/CHEMBL4214471
For the given ligand baicalein, we have found in our database that, being scored 0.109375, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| baicalein (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| O=c2cc(c1ccccc1)oc3cc(O)c(O)c(O)c23 | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00402001 00200008 20080100 00010200 00000200 80004020 02000000 40800200 02084100 40000840 00000090 41008000 40008402 00200088 00000020 00008208 00064000 02000840 0e000200 00820a00 00240000 08000028 10010000 00580000 08000000 80000000 040000b4 08100040 00006000 01820800 40000040 00000000 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |