On Target PA_INFA 0.46226415/CHEMBL4457315
For the given ligand baicalein, we have found in our database that, being scored 0.46226415, the most similar ligand is CHEMBL4457315. Check out the elaboration below.
| baicalein (Given Ligand) | CHEMBL4457315 (Similar Ligand) |
|---|---|
| O=c2cc(c1ccccc1)oc3cc(O)c(O)c(O)c23 | O=c1oc2ccc(-c3ccc(F)cc3)cc2cc1O |
|
|
|
|
|
|
| 00402001 00200008 20080100 00010200 00000200 80004020 02000000 40800200 02084100 40000840 00000090 41008000 40008402 00200088 00000020 00008208 00064000 02000840 0e000200 00820a00 00240000 08000028 10010000 00580000 08000000 80000000 040000b4 08100040 00006000 01820800 40000040 00000000 | 00002000 00200008 20180100 02010200 0081021c 00400030 02000000 40000200 02024000 40000840 000000a0 40508000 40008402 00201080 00000080 00000008 00020000 02000000 04000000 00120200 00000000 0a000008 10000008 00580000 08400000 80000000 00000010 08100041 02006000 01028000 00000000 00000200 |