On Target DPM_HHV1K 0.21052632/CHEMBL481172
For the given ligand baicalein, we have found in our database that, being scored 0.21052632, the most similar ligand is CHEMBL481172. Check out the elaboration below.
| baicalein (Given Ligand) | CHEMBL481172 (Similar Ligand) |
|---|---|
| O=c2cc(c1ccccc1)oc3cc(O)c(O)c(O)c23 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccco1 |
|
|
|
|
|
|
| 00402001 00200008 20080100 00010200 00000200 80004020 02000000 40800200 02084100 40000840 00000090 41008000 40008402 00200088 00000020 00008208 00064000 02000840 0e000200 00820a00 00240000 08000028 10010000 00580000 08000000 80000000 040000b4 08100040 00006000 01820800 40000040 00000000 | 1041818a 00a2d800 80184101 00014610 04041683 80004000 00004400 4a281200 020841e1 800808d0 01200434 4001b802 c6089c6e 01600188 00004460 000c040c 10026000 c200c004 02200080 08000200 c0000000 1a268f10 22a04000 a159001c 30842070 e0000402 0c940054 98040000 24402101 03860043 e0140000 80020600 |