On Target GP_EBOV 0.14084508/CHEMBL1655
For the given ligand baicalein, we have found in our database that, being scored 0.14084508, the most similar ligand is CHEMBL1655. Check out the elaboration below.
| baicalein (Given Ligand) | CHEMBL1655 (Similar Ligand) |
|---|---|
| O=c2cc(c1ccccc1)oc3cc(O)c(O)c(O)c23 | CN(C)CCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
|
|
|
|
|
|
| 00402001 00200008 20080100 00010200 00000200 80004020 02000000 40800200 02084100 40000840 00000090 41008000 40008402 00200088 00000020 00008208 00064000 02000840 0e000200 00820a00 00240000 08000028 10010000 00580000 08000000 80000000 040000b4 08100040 00006000 01820800 40000040 00000000 | 04022000 00000008 20000308 00010602 00001080 00000000 82040080 01008400 00000800 00180840 08300500 40018000 00800002 00000000 01001003 00080008 00000400 02000000 00000000 00020001 00000100 18040100 12008081 00400010 01000000 a8000000 00522000 40000008 00400280 00060002 04000000 00820600 |