On Target NS5B_HCV1A 0.1632653/CHEMBL178973
For the given ligand baicalein, we have found in our database that, being scored 0.1632653, the most similar ligand is CHEMBL178973. Check out the elaboration below.
| baicalein (Given Ligand) | CHEMBL178973 (Similar Ligand) |
|---|---|
| O=c2cc(c1ccccc1)oc3cc(O)c(O)c(O)c23 | N#Cc1c(Cl)cc(Cl)cc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00402001 00200008 20080100 00010200 00000200 80004020 02000000 40800200 02084100 40000840 00000090 41008000 40008402 00200088 00000020 00008208 00064000 02000840 0e000200 00820a00 00240000 08000028 10010000 00580000 08000000 80000000 040000b4 08100040 00006000 01820800 40000040 00000000 | 0005a000 01000801 00000102 00810200 00080021 00000020 44000000 00000000 04100900 00880840 08100000 4001d800 06008004 00200408 a0000000 08082008 00420000 02001000 04c00008 00002001 00000100 08020b00 11000480 00400014 00002800 80000280 00040000 00000041 10004002 00020402 80000000 00420400 |