On Target NA_A-H3N8 0.13461539/CHEMBL4288395
For the given ligand baicalein, we have found in our database that, being scored 0.13461539, the most similar ligand is CHEMBL4288395. Check out the elaboration below.
| baicalein (Given Ligand) | CHEMBL4288395 (Similar Ligand) |
|---|---|
| O=c2cc(c1ccccc1)oc3cc(O)c(O)c(O)c23 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(-c3ccc(SC)cc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00402001 00200008 20080100 00010200 00000200 80004020 02000000 40800200 02084100 40000840 00000090 41008000 40008402 00200088 00000020 00008208 00064000 02000840 0e000200 00820a00 00240000 08000028 10010000 00580000 08000000 80000000 040000b4 08100040 00006000 01820800 40000040 00000000 | 00072040 09807200 00120100 84110700 00180080 00000800 02080180 3a00140e 11000100 001108c8 40200000 61019001 8402881a 01892000 00001408 00081008 14a24000 02000060 64c12010 10000201 80000020 38048e80 13808080 02500019 10001401 c0001400 00c04000 90000041 0c004300 00060401 24060000 00810a30 |