On Target NS3_HCV1A 0.375/CHEMBL4107993
For the given ligand Naringenin, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL4107993. Check out the elaboration below.
| Naringenin (Given Ligand) | CHEMBL4107993 (Similar Ligand) |
|---|---|
| O=C2CC(c1ccc(O)cc1)Oc3cc(O)cc(O)c23 | CC[C@@H](N)c1ccc(OC)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 04000001 01000818 2000010b 00010300 00001000 82224000 42000000 00000200 00000900 00080840 08100000 40009060 14808002 00210000 11000001 020a2008 00000000 02008000 00400008 00020801 00000100 08020220 01000060 00c01014 00004800 c0002000 00520800 00000000 00010300 00034002 c0000000 00000400 | 00000040 00000808 20100108 02010600 00001201 00020010 02040000 01001200 00000800 00088e40 08100000 40008200 00008842 00001000 01000001 08082008 03000200 02000000 00000400 00020001 00000100 18028200 01000000 12400014 00000000 e0000000 08320800 40800001 00000380 00068002 82040010 00000600 |