On Target ACE2_HUMAN 0.4532374/CHEMBL254493
For the given ligand Naringenin, we have found in our database that, being scored 0.4532374, the most similar ligand is CHEMBL254493. Check out the elaboration below.
| Naringenin (Given Ligand) | CHEMBL254493 (Similar Ligand) |
|---|---|
| O=C2CC(c1ccc(O)cc1)Oc3cc(O)cc(O)c23 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1OCc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 04000001 01000818 2000010b 00010300 00001000 82224000 42000000 00000200 00000900 00080840 08100000 40009060 14808002 00210000 11000001 020a2008 00000000 02008000 00400008 00020801 00000100 08020220 01000060 00c01014 00004800 c0002000 00520800 00000000 00010300 00034002 c0000000 00000400 | 04010000 01005008 20100108 00110600 00001080 80004000 86000000 20000204 00000980 020a08c0 08300000 4001b0c0 06808002 00050000 81080001 02082008 90000000 02008000 00400008 00020201 00000100 18200e20 03000140 85d01418 00004800 c0002000 00000000 10000040 04000300 00070003 60004000 03012600 |