On Target PR_HIV1 0.23655914/CHEMBL492666
For the given ligand Naringenin, we have found in our database that, being scored 0.23655914, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Naringenin (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| O=C2CC(c1ccc(O)cc1)Oc3cc(O)cc(O)c23 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 04000001 01000818 2000010b 00010300 00001000 82224000 42000000 00000200 00000900 00080840 08100000 40009060 14808002 00210000 11000001 020a2008 00000000 02008000 00400008 00020801 00000100 08020220 01000060 00c01014 00004800 c0002000 00520800 00000000 00010300 00034002 c0000000 00000400 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |