On Target RT_HIV1 0.3596059/CHEMBL4225865
For the given ligand N3, we have found in our database that, being scored 0.3596059, the most similar ligand is CHEMBL4225865. Check out the elaboration below.
| N3 (Given Ligand) | CHEMBL4225865 (Similar Ligand) |
|---|---|
| Cc3cc(C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](/C=C\C(=O)OCc1ccccc1)C[C@@H]2CCNC2=O)C(C)C)no3 | C=C(C)[C@@H]1CC[C@]2(CN(CCN(C)C)C(=O)CCC(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00038080 0100f000 001a0100 26010e00 00000410 00104810 12100080 28003408 01220100 001188c0 40210000 4003b000 06028042 00013041 d0000400 0a0c000e 22020200 02020500 22012010 01101201 00802000 38068fb4 00808203 2258009c 00001400 c800ac00 08c84020 98401121 08000304 02060001 ec004000 42802230 | 00060000 01003800 00100302 44050600 00100000 00004000 80000080 2000040a 00000900 001808c0 08300000 40019800 04028002 00202000 00000402 00080008 00000400 02000020 02412000 00000201 01000100 38060e30 01008021 0250001c 01200000 80000000 00406000 d0000000 08400002 01060003 e4020000 00802e00 |