On Target NS5B_HCV1B 0.2290749/CHEMBL3645180
For the given ligand Naringenin, we have found in our database that, being scored 0.2290749, the most similar ligand is CHEMBL3645180. Check out the elaboration below.
| Naringenin (Given Ligand) | CHEMBL3645180 (Similar Ligand) |
|---|---|
| O=C2CC(c1ccc(O)cc1)Oc3cc(O)cc(O)c23 | CCN(c1cc2nn(-c3ccc(Oc4ccccc4F)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 04000001 01000818 2000010b 00010300 00001000 82224000 42000000 00000200 00000900 00080840 08100000 40009060 14808002 00210000 11000001 020a2008 00000000 02008000 00400008 00020801 00000100 08020220 01000060 00c01014 00004800 c0002000 00520800 00000000 00010300 00034002 c0000000 00000400 | 00004006 00805e08 2018090a 43310e00 010c1000 00004052 02040000 02001408 00100900 000908c0 09312024 40118800 80008c23 01401201 810a0841 000e200c 04268800 02000004 08602008 00224201 c0500101 3c838e38 20800800 8360001c 02104080 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |