On Target NA_INFB 0.21910113/CHEMBL79499
For the given ligand Naringenin, we have found in our database that, being scored 0.21910113, the most similar ligand is CHEMBL79499. Check out the elaboration below.
| Naringenin (Given Ligand) | CHEMBL79499 (Similar Ligand) |
|---|---|
| O=C2CC(c1ccc(O)cc1)Oc3cc(O)cc(O)c23 | CC[C@H](CCc1ccccc1)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 04000001 01000818 2000010b 00010300 00001000 82224000 42000000 00000200 00000900 00080840 08100000 40009060 14808002 00210000 11000001 020a2008 00000000 02008000 00400008 00020801 00000100 08020220 01000060 00c01014 00004800 c0002000 00520800 00000000 00010300 00034002 c0000000 00000400 | 00070040 09007008 00100102 80010700 00180080 00000800 02080180 38000402 11000800 001808c8 48300000 41019001 0402801a 01a80000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000120 38040e80 13008040 02500018 10001400 80001400 00c04000 90000001 0c000202 00060403 04020000 00000610 |