On Target NA_INFB 0.13612565/CHEMBL79499
For the given ligand Luteolin, we have found in our database that, being scored 0.13612565, the most similar ligand is CHEMBL79499. Check out the elaboration below.
| Luteolin (Given Ligand) | CHEMBL79499 (Similar Ligand) |
|---|---|
| O=c2cc(c1ccc(O)c(O)c1)oc3cc(O)cc(O)c23 | CC[C@H](CCc1ccccc1)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00402001 40200018 20080100 00110200 00000200 80004020 02000000 40800200 02084100 40000840 00000010 41008000 40008412 00200088 00000020 00008208 00064040 02000840 0e000200 00821a00 00240000 08000828 10000000 00580000 08000000 80000000 040200b4 08100040 00006000 01820800 40000040 00000000 | 00070040 09007008 00100102 80010700 00180080 00000800 02080180 38000402 11000800 001808c8 48300000 41019001 0402801a 01a80000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000120 38040e80 13008040 02500018 10001400 80001400 00c04000 90000001 0c000202 00060403 04020000 00000610 |