On Target NP_HCoV-OC43 0.12560387/CHEMBL3233481
For the given ligand N3, we have found in our database that, being scored 0.12560387, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| N3 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Cc3cc(C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](/C=C\C(=O)OCc1ccccc1)C[C@@H]2CCNC2=O)C(C)C)no3 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00038080 0100f000 001a0100 26010e00 00000410 00104810 12100080 28003408 01220100 001188c0 40210000 4003b000 06028042 00013041 d0000400 0a0c000e 22020200 02020500 22012010 01101201 00802000 38068fb4 00808203 2258009c 00001400 c800ac00 08c84020 98401121 08000304 02060001 ec004000 42802230 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |