On Target PLP_SARS 0.6229508/CHEMBL213543
For the given ligand N3, we have found in our database that, being scored 0.6229508, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| N3 (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| Cc3cc(C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](/C=C\C(=O)OCc1ccccc1)C[C@@H]2CCNC2=O)C(C)C)no3 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 00038080 0100f000 001a0100 26010e00 00000410 00104810 12100080 28003408 01220100 001188c0 40210000 4003b000 06028042 00013041 d0000400 0a0c000e 22020200 02020500 22012010 01101201 00802000 38068fb4 00808203 2258009c 00001400 c800ac00 08c84020 98401121 08000304 02060001 ec004000 42802230 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |