On Target NA_INFB 0.0952381/CHEMBL335808
For the given ligand pyrazinamide, we have found in our database that, being scored 0.0952381, the most similar ligand is CHEMBL335808. Check out the elaboration below.
| pyrazinamide (Given Ligand) | CHEMBL335808 (Similar Ligand) |
|---|---|
| C1CC1C2CC2 | CCCC[C@H](NC(C)=O)[C@@H]1CC(C(=O)O)C[C@H]1N=C(N)N |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 01000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00030000 01001400 00100000 00000c00 00180000 00000000 00010000 20000000 00000000 00020182 00200010 40011000 0400801a 01800008 00000000 00080008 00000800 00000000 00402000 00000201 00000000 300c0e10 01000001 02100018 00000000 00000000 40030000 10000008 08800000 01040011 00020000 00000200 |