On Target ACE2_HUMAN 0.27102804/CHEMBL398545
For the given ligand 2, we have found in our database that, being scored 0.27102804, the most similar ligand is CHEMBL398545. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL398545 (Similar Ligand) |
|---|---|
| c1cc2CCCCC3CCCc(c1)c23 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1-c1ccccc1)C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000002 00000000 00000001 00000800 00080840 08100000 40008000 00000000 00200000 00000020 00080008 01000200 02000000 00002000 00000001 00000100 08000000 01004000 00400010 00000000 80000001 00000000 00800000 00000002 00020002 00020000 00000400 | 00012000 01005001 00100100 00110600 000200a0 00000000 81001000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00240000 a0080000 00080008 10020200 02000000 04400008 00000201 00000100 18200e00 13004140 85500018 00800800 80000001 00000000 10000040 04004000 00060403 20004000 03012600 |