On Target NS5B_HCV1A 0.23041475/CHEMBL446360
For the given ligand Virus T, we have found in our database that, being scored 0.23041475, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| Virus T (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| CC(SSCc1nncc2c1OCC3CCCOC23)C4CC4 | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 04004040 43000018 6010218a 40910710 81080154 6a00830a 40002001 00800a00 10800900 01080808 00100040 6804a040 0a001046 0ba50000 11000800 020c301c 80a40911 22008304 01602000 402e0201 80030064 3c000000 01800940 02400418 00102401 c0000000 111a0200 10100000 04018306 00064182 c0004004 0b410020 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |