On Target NS5B_HCV1B 0.26333332/CHEMBL3645204
For the given ligand Virus T, we have found in our database that, being scored 0.26333332, the most similar ligand is CHEMBL3645204. Check out the elaboration below.
| Virus T (Given Ligand) | CHEMBL3645204 (Similar Ligand) |
|---|---|
| CC(SSCc1nncc2c1OCC3CCCOC23)C4CC4 | CNC(=O)c1c2cc(C3CC3)c(N(CCC3COC(C)(C)OC3)S(C)(=O)=O)cc2nn1-c1ccc(Cl)cc1 |
|
|
|
|
|
|
| 04004040 43000018 6010218a 40910710 81080154 6a00830a 40002001 00800a00 10800900 01080808 00100040 6804a040 0a001046 0ba50000 11000800 020c301c 80a40911 22008304 01602000 402e0201 80030064 3c000000 01800940 02400418 00102401 c0000000 111a0200 10100000 04018306 00064182 c0004004 0b410020 | 0000c006 04805e08 20180902 41310f00 211c0040 00006042 02840800 02001408 00300900 014908e0 09312024 40118800 82008c27 01400201 804a0040 002e300e 04268000 02000604 09608008 00224201 c0100121 1c838f38 21800800 9360001c 02106480 c0000040 002f0280 b400108c 0c488304 0046004b c4248080 a0134ff0 |