On Target NA_INFB 0.26872247/CHEMBL362993
For the given ligand Virus T, we have found in our database that, being scored 0.26872247, the most similar ligand is CHEMBL362993. Check out the elaboration below.
| Virus T (Given Ligand) | CHEMBL362993 (Similar Ligand) |
|---|---|
| CC(SSCc1nncc2c1OCC3CCCOC23)C4CC4 | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1cc[nH]n1 |
|
|
|
|
|
|
| 04004040 43000018 6010218a 40910710 81080154 6a00830a 40002001 00800a00 10800900 01080808 00100040 6804a040 0a001046 0ba50000 11000800 020c301c 80a40911 22008304 01602000 402e0201 80030064 3c000000 01800940 02400418 00102401 c0000000 111a0200 10100000 04018306 00064182 c0004004 0b410020 | 04010000 01003208 20100102 04000600 01080080 00000012 00000020 20000208 00000880 000c0080 00308000 400130c0 1e00801a 01a02001 81180000 000c200c 90000000 0e000000 00402000 00220241 00100000 32240e30 07800801 03100018 00002000 00000000 00120000 10000180 0c000006 0006c00b 00024000 00c02e20 |