On Target RDRP_SARS2 0.26331362/CHEMBL4065616
For the given ligand Virus T, we have found in our database that, being scored 0.26331362, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| Virus T (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| CC(SSCc1nncc2c1OCC3CCCOC23)C4CC4 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 04004040 43000018 6010218a 40910710 81080154 6a00830a 40002001 00800a00 10800900 01080808 00100040 6804a040 0a001046 0ba50000 11000800 020c301c 80a40911 22008304 01602000 402e0201 80030064 3c000000 01800940 02400418 00102401 c0000000 111a0200 10100000 04018306 00064182 c0004004 0b410020 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |