On Target NS3_HCV1A 0.4144144/CHEMBL3955976
For the given ligand N3, we have found in our database that, being scored 0.4144144, the most similar ligand is CHEMBL3955976. Check out the elaboration below.
| N3 (Given Ligand) | CHEMBL3955976 (Similar Ligand) |
|---|---|
| Cc3cc(C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](/C=C\C(=O)OCc1ccccc1)C[C@@H]2CCNC2=O)C(C)C)no3 | CC[C@@H](N[C@@H](C)CC(N)=O)c1ccc(Cl)c(C(=O)c2cc(C)on2)c1F |
|
|
|
|
|
|
| 00038080 0100f000 001a0100 26010e00 00000410 00104810 12100080 28003408 01220100 001188c0 40210000 4003b000 06028042 00013041 d0000400 0a0c000e 22020200 02020500 22012010 01101201 00802000 38068fb4 00808203 2258009c 00001400 c800ac00 08c84020 98401121 08000304 02060001 ec004000 42802230 | 000080c0 00002c00 001a0100 32010600 00000201 00100010 30000000 23001000 00020900 00080fc0 08308000 40009a00 0e008866 00001044 54000400 080c000e 03000200 03010402 02000410 10900201 00802500 18028702 01800200 30480094 00003000 e0000200 08840020 c8c01081 00200184 00068033 ac040000 40022620 |