On Target NS3_HCV1A 0.23979592/CHEMBL3645746
For the given ligand DB06145, we have found in our database that, being scored 0.23979592, the most similar ligand is CHEMBL3645746. Check out the elaboration below.
| DB06145 (Given Ligand) | CHEMBL3645746 (Similar Ligand) |
|---|---|
| CO[C@H]2[C@H](O)CC(=O)O[C@H](C)C/C=C\C=C/[C@H](O[C@@H]1CC[C@@H](N(C)C)[C@@H](C)O1)[C@H](C)C[C@H](CC=O)[C@H]2O[C@@H]4O[C@H](C)[C@H](O[C@H]3C[C@@](C)(O)[C@@H](O)[C@@H](C)O3)[C@H](N(C)C)[C@@H]4O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)CC1CCCCO1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00050040 01040000 00100100 80810700 c03801c0 00800001 02003800 08000440 00202000 011000a0 40200200 40009000 14028028 028a0000 0000140c 002a900c 00a20040 00000100 31c0a090 00008001 00100020 10001a00 1740a080 08000012 10001400 00000000 00406200 b4000020 00000242 00040000 24e20000 04000a10 | 000100e0 09003000 06100100 05210500 800c0000 00200010 000a0000 20001408 10000000 0010c188 00602000 4001b000 1601801a 01882011 a0400400 00081008 04204000 00000000 46c12000 00004201 00000020 30040630 01000083 32900038 00000401 00000000 00000000 90000010 08000200 c0040081 64024004 00012260 |