On Target NS3_HCV1B 0.24299066/CHEMBL3954962
For the given ligand DB09134, we have found in our database that, being scored 0.24299066, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| DB09134 (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| O=C(CO)N(CCO)c1c(I)c(C(=O)NC[C@H](O)CO)c(I)c(C(=O)NC[C@H](O)CO)c1I | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 1000500a 00005800 40181100 00010600 04000081 08408000 10800000 02001000 00800201 00000c50 00280004 4000c000 00008842 02100000 00280440 18080008 10040000 02000000 08800900 20000204 40110040 18128600 27012080 0050001c 00040001 c0000000 08c00080 90000080 20408100 00060001 a0240000 00000200 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |