On Target RT_HIV1 0.28484848/CHEMBL4227382
For the given ligand DB09134, we have found in our database that, being scored 0.28484848, the most similar ligand is CHEMBL4227382. Check out the elaboration below.
| DB09134 (Given Ligand) | CHEMBL4227382 (Similar Ligand) |
|---|---|
| O=C(CO)N(CCO)c1c(I)c(C(=O)NC[C@H](O)CO)c(I)c(C(=O)NC[C@H](O)CO)c1I | C=C(C)[C@@H]1CC[C@]2(CNCCCN(C)c3ccccc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 1000500a 00005800 40181100 00010600 04000081 08408000 10800000 02001000 00800201 00000c50 00280004 4000c000 00008842 02100000 00280440 18080008 10040000 02000000 08800900 20000204 40110040 18128600 27012080 0050001c 00040001 c0000000 08c00080 90000080 20408100 00060001 a0240000 00000200 | 00004002 01000c00 00100302 40050600 20000000 00004000 80000080 20000402 00000900 001809e0 08300004 40018800 00028002 00200000 00020442 00080008 00040400 02000020 0a012000 00000201 61100100 18020a30 20008020 00500014 01200000 80000000 00406000 d0000080 00408002 01060012 e4020000 00002600 |