On Target NS5B_HCV1A 0.4/CHEMBL13443
For the given ligand DB12865, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL13443. Check out the elaboration below.
| DB12865 (Given Ligand) | CHEMBL13443 (Similar Ligand) |
|---|---|
| CC(=O)N[C@H](CSSC[C@@H](N)C(=O)O)C(=O)N[C@H](C)C(=O)N[C@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](CCCNC(=N)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(N)=O | C=CCNC(=O)C(=O)[C@H](CC)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(C)C |
|
|
|
|
|
|
| 00010001 81003010 60100000 44100d00 00000000 00000100 00000000 20002008 00200200 02010082 00200000 40033000 06009016 00042001 80000000 00180008 00000000 00000000 00000000 004c2301 40000040 30050e20 03000603 06100018 00000000 00800000 40000400 50000000 08000010 00048021 a0084000 03412200 | 00070000 01003400 00100000 04000400 00180000 00000010 00000000 20000408 04000000 000201a0 00200800 40013000 0e008032 01012001 80000000 00080008 00000000 00000101 00c00010 00000201 00000000 300c0e20 01000003 02100018 00001000 00000000 00080000 10000000 08000002 00040011 2c004000 02802a00 |