On Target PR_SARS 0.2/CHEMBL2441741
For the given ligand DB09134, we have found in our database that, being scored 0.2, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| DB09134 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| O=C(CO)N(CCO)c1c(I)c(C(=O)NC[C@H](O)CO)c(I)c(C(=O)NC[C@H](O)CO)c1I | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 1000500a 00005800 40181100 00010600 04000081 08408000 10800000 02001000 00800201 00000c50 00280004 4000c000 00008842 02100000 00280440 18080008 10040000 02000000 08800900 20000204 40110040 18128600 27012080 0050001c 00040001 c0000000 08c00080 90000080 20408100 00060001 a0240000 00000200 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |