On Target PLP_SARS 0.34810126/CHEMBL213054
For the given ligand DB12865, we have found in our database that, being scored 0.34810126, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| DB12865 (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC(=O)N[C@H](CSSC[C@@H](N)C(=O)O)C(=O)N[C@H](C)C(=O)N[C@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](CCCNC(=N)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(N)=O | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00010001 81003010 60100000 44100d00 00000000 00000100 00000000 20002008 00200200 02010082 00200000 40033000 06009016 00042001 80000000 00180008 00000000 00000000 00000000 004c2301 40000040 30050e20 03000603 06100018 00000000 00800000 40000400 50000000 08000010 00048021 a0084000 03412200 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |