On Target NS3_HCV1A 0.4651163/CHEMBL296588
For the given ligand DB12839, we have found in our database that, being scored 0.4651163, the most similar ligand is CHEMBL296588. Check out the elaboration below.
| DB12839 (Given Ligand) | CHEMBL296588 (Similar Ligand) |
|---|---|
| COCCOCCCCCC(=O)NCCCC[C@H](N)C(=O)O | CC(C)CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)O)C(C)C)C(C)C |
|
|
|
|
|
|
| 00010000 01001000 00100000 00010500 00080000 00000000 00000000 20000040 00002000 00000080 00200000 4001b000 0400800a 00800000 00000000 00089008 00800000 00000000 00402000 00000201 00000020 10040e30 07000000 08100018 00000400 00000000 00000000 10000020 00000200 00040001 00000000 00002200 | 00030000 01007000 00100000 04000400 00180080 00000000 00000000 20000008 00200000 00000080 00200000 40033000 1600800a 00802001 80180000 00080008 10000000 00000000 01c02000 00000201 00000000 30040e10 03000083 02100018 00000001 00000000 00000000 10000000 08000000 00040001 20024000 00802a00 |