On Target NS3_HCV1A 0.23766816/CHEMBL3895952
For the given ligand DB09050, we have found in our database that, being scored 0.23766816, the most similar ligand is CHEMBL3895952. Check out the elaboration below.
| DB09050 (Given Ligand) | CHEMBL3895952 (Similar Ligand) |
|---|---|
| Cn1c(N)c(NC(=O)NCCN)c[n+]1C/C4=C(C(=O)[O-])/N3C(=O)[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2nsc(N)n2)[C@H]3SC4 | CNC(=O)c1c2cc(-c3ccc4c(n3)-c3cc5c(F)cccc5n3CC4)c(N(C)S(C)(=O)=O)cc2nn1-c1ccc(F)cc1 |
|
|
|
|
|
|
| 04400087 c2806858 a0534200 0c310f60 01090088 98002000 c22c032c 9022a50d 1338a581 9a07c2c1 012b968d 600df941 8e01f886 00ac2105 851f0087 004c405c 74e00d01 08c443c0 21c10018 0372272c c0008580 b9018f92 af9a7b01 16400018 45001202 2c400f24 40c54020 c40605d8 0c00100c e0463123 24087091 a3b383e8 | 00006206 00805e09 32184902 53310e10 218c1061 00004032 02042010 02181448 00510900 302918d0 0131a124 40118800 81008c23 00681201 a00a0040 020e200d 04260000 16002004 0c600400 10724206 c5180001 1c038e38 31805820 8360001c 01944080 c0000040 082700c0 900050df 0c40c10c 0067844b c4049a00 801147e0 |