On Target ACE2_HUMAN 0.4408602/CHEMBL350414
For the given ligand DB04825, we have found in our database that, being scored 0.4408602, the most similar ligand is CHEMBL350414. Check out the elaboration below.
| DB04825 (Given Ligand) | CHEMBL350414 (Similar Ligand) |
|---|---|
| C[C@@H](Cc1ccccc1)NCCC(c2ccccc2)c3ccccc3 | O=C(N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O)[C@@H](S)Cc1ccccc1 |
|
|
|
|
|
|
| 00000000 00000200 00100100 00010600 00000000 00000000 00000000 21000000 00000880 000808c0 08300000 40008000 00000002 00000000 00000000 00040000 00000000 02000000 00000000 00000201 00000100 18200000 00000000 81400010 00000000 a0000000 00000000 50000000 04000080 0006000a 00000000 00002600 | 00002000 00005200 00100100 00110600 00000080 00000000 80000000 20000004 00000980 030b08c0 08300000 4000b800 06008002 00040000 80080000 000c0008 10020000 02000000 04400008 10000201 00000100 18200e00 13000040 87400018 00000800 80000000 00000000 10000040 04004000 0006000b 20004000 03012600 |