On Target NS3_HCV1B 0.16972478/CHEMBL1170408
For the given ligand DB04825, we have found in our database that, being scored 0.16972478, the most similar ligand is CHEMBL1170408. Check out the elaboration below.
| DB04825 (Given Ligand) | CHEMBL1170408 (Similar Ligand) |
|---|---|
| C[C@@H](Cc1ccccc1)NCCC(c2ccccc2)c3ccccc3 | C=CCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 00000000 00000200 00100100 00010600 00000000 00000000 00000000 21000000 00000880 000808c0 08300000 40008000 00000002 00000000 00000000 00040000 00000000 02000000 00000000 00000201 00000100 18200000 00000000 81400010 00000000 a0000000 00000000 50000000 04000080 0006000a 00000000 00002600 | 08012082 65c03008 20184108 15310600 00241021 00018000 96060080 22081408 20800284 105988c0 08202404 4011b000 0f00c802 00442001 c1420441 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |