On Target PA_INFA 0.21671018/CHEMBL2040602
For the given ligand DB09050, we have found in our database that, being scored 0.21671018, the most similar ligand is CHEMBL2040602. Check out the elaboration below.
| DB09050 (Given Ligand) | CHEMBL2040602 (Similar Ligand) |
|---|---|
| Cn1c(N)c(NC(=O)NCCN)c[n+]1C/C4=C(C(=O)[O-])/N3C(=O)[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2nsc(N)n2)[C@H]3SC4 | COc1ccc(/C=C2\N=C(CC(C)C)C(=O)N(O)C2=O)cc1 |
|
|
|
|
|
|
| 04400087 c2806858 a0534200 0c310f60 01090088 98002000 c22c032c 9022a50d 1338a581 9a07c2c1 012b968d 600df941 8e01f886 00ac2105 851f0087 004c405c 74e00d01 08c443c0 21c10018 0372272c c0008580 b9018f92 af9a7b01 16400018 45001202 2c400f24 40c54020 c40605d8 0c00100c e0463123 24087091 a3b383e8 | 00412002 0100b018 60304108 00190e08 00029002 04000200 96140080 20a20410 03800002 22410cc1 00230000 4001b000 0410a006 08010002 03000003 00000018 e0000c00 52004300 00018002 11ce0209 00020001 38040600 80020001 06500818 02000080 80000000 404a2000 54050104 08400200 00068005 1c000000 02000200 |