On Target PR_HIV1 0.1975/CHEMBL449291
For the given ligand DB09050, we have found in our database that, being scored 0.1975, the most similar ligand is CHEMBL449291. Check out the elaboration below.
| DB09050 (Given Ligand) | CHEMBL449291 (Similar Ligand) |
|---|---|
| Cn1c(N)c(NC(=O)NCCN)c[n+]1C/C4=C(C(=O)[O-])/N3C(=O)[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2nsc(N)n2)[C@H]3SC4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCS(=O)(=O)CCOC2)cc1 |
|
|
|
|
|
|
| 04400087 c2806858 a0534200 0c310f60 01090088 98002000 c22c032c 9022a50d 1338a581 9a07c2c1 012b968d 600df941 8e01f886 00ac2105 851f0087 004c405c 74e00d01 08c443c0 21c10018 0372272c c0008580 b9018f92 af9a7b01 16400018 45001202 2c400f24 40c54020 c40605d8 0c00100c e0463123 24087091 a3b383e8 | 00000010 05c05409 2110050b 01b10600 000810c0 00028020 02000000 20000044 00542a00 014849e0 0830b000 60018010 00008002 80240001 81e80011 001a0008 14022000 02080000 01400800 01027603 80000120 18280c90 07100240 d9500058 02020400 8000001e 00800020 102020ec 04000600 22060013 80000000 04012670 |