On Target RT_HIV1 0.27272728/CHEMBL3943252
For the given ligand DB09050, we have found in our database that, being scored 0.27272728, the most similar ligand is CHEMBL3943252. Check out the elaboration below.
| DB09050 (Given Ligand) | CHEMBL3943252 (Similar Ligand) |
|---|---|
| Cn1c(N)c(NC(=O)NCCN)c[n+]1C/C4=C(C(=O)[O-])/N3C(=O)[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2nsc(N)n2)[C@H]3SC4 | CC(C)CN(C(CO)c1ccc(CNC(=O)C(NC(=O)c2ccccc2)C(c2ccccc2)c2cnc[nH]2)s1)S(=O)(=O)c1ccc2ncsc2c1 |
|
|
|
|
|
|
| 04400087 c2806858 a0534200 0c310f60 01090088 98002000 c22c032c 9022a50d 1338a581 9a07c2c1 012b968d 600df941 8e01f886 00ac2105 851f0087 004c405c 74e00d01 08c443c0 21c10018 0372272c c0008580 b9018f92 af9a7b01 16400018 45001202 2c400f24 40c54020 c40605d8 0c00100c e0463123 24087091 a3b383e8 | 0c038012 10803a00 03180108 05b10611 140c02c0 000a8000 040068a1 2700d00e 00460980 00491ac0 2930aa04 f000b880 8620a832 00542821 816e24c0 000c160c 18413020 0e11008d 00700018 40006e0d e0001d00 782a8680 23900200 db41005c 42041800 cc010304 40000800 d000210c 0c200784 2046000f e0044000 20c107e0 |