On Target NS5B_HCV1A 0.39423078/CHEMBL320324
For the given ligand DB12839, we have found in our database that, being scored 0.39423078, the most similar ligand is CHEMBL320324. Check out the elaboration below.
| DB12839 (Given Ligand) | CHEMBL320324 (Similar Ligand) |
|---|---|
| COCCOCCCCCC(=O)NCCCC[C@H](N)C(=O)O | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C1CCCC1)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00010000 01001000 00100000 00010500 00080000 00000000 00000000 20000040 00002000 00000080 00200000 4001b000 0400800a 00800000 00000000 00089008 00800000 00000000 00402000 00000201 00000020 10040e30 07000000 08100018 00000400 00000000 00000000 10000020 00000200 00040001 00000000 00002200 | 00010000 01403000 00100000 04000600 00081000 00018000 00000000 20000008 04800200 00000080 00200000 4001f000 0e00800a 00002001 80000000 001a0408 000a0000 00080001 00c02810 00000201 00000000 30140e50 01000083 02100018 00001001 00000082 00000060 90200020 08000200 03040001 a0024000 00002200 |