On Target NS5B_HCV1A 0.2765432/CHEMBL3644907
For the given ligand DB09050, we have found in our database that, being scored 0.2765432, the most similar ligand is CHEMBL3644907. Check out the elaboration below.
| DB09050 (Given Ligand) | CHEMBL3644907 (Similar Ligand) |
|---|---|
| Cn1c(N)c(NC(=O)NCCN)c[n+]1C/C4=C(C(=O)[O-])/N3C(=O)[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2nsc(N)n2)[C@H]3SC4 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(-n3cccn3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 04400087 c2806858 a0534200 0c310f60 01090088 98002000 c22c032c 9022a50d 1338a581 9a07c2c1 012b968d 600df941 8e01f886 00ac2105 851f0087 004c405c 74e00d01 08c443c0 21c10018 0372272c c0008580 b9018f92 af9a7b01 16400018 45001202 2c400f24 40c54020 c40605d8 0c00100c e0463123 24087091 a3b383e8 | 00014086 0d403608 20100120 05390f00 20080000 0001c000 000a0004 a000340d 10800300 00538be8 01202404 5001b000 0e00f802 01042101 80420440 001e800c 02864010 00482000 48610850 00224a01 60100100 bc058e30 21820803 b304003a 02112000 00001002 00000000 902000ac 0c008200 8146009b e41c4000 810166f0 |