On Target NS5B_HCV1B 0.26119402/CHEMBL3645208
For the given ligand DB09050, we have found in our database that, being scored 0.26119402, the most similar ligand is CHEMBL3645208. Check out the elaboration below.
| DB09050 (Given Ligand) | CHEMBL3645208 (Similar Ligand) |
|---|---|
| Cn1c(N)c(NC(=O)NCCN)c[n+]1C/C4=C(C(=O)[O-])/N3C(=O)[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2nsc(N)n2)[C@H]3SC4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCO)S(C)(=O)=O)cc2nn1-c1ccc(Cl)cc1 |
|
|
|
|
|
|
| 04400087 c2806858 a0534200 0c310f60 01090088 98002000 c22c032c 9022a50d 1338a581 9a07c2c1 012b968d 600df941 8e01f886 00ac2105 851f0087 004c405c 74e00d01 08c443c0 21c10018 0372272c c0008580 b9018f92 af9a7b01 16400018 45001202 2c400f24 40c54020 c40605d8 0c00100c e0463123 24087091 a3b383e8 | 0000c006 00805e08 20180902 41310e00 210c0000 00004042 02040000 02001408 00100900 004908c0 09312024 40118800 82008c27 01400201 810a0040 000e200e 04268000 02400604 08e00008 00224205 c0100101 1c838f38 21800880 9360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |