On Target RDRP_SARS2 0.13818182/CHEMBL4065616
For the given ligand DB12839, we have found in our database that, being scored 0.13818182, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| DB12839 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| COCCOCCCCCC(=O)NCCCC[C@H](N)C(=O)O | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00010000 01001000 00100000 00010500 00080000 00000000 00000000 20000040 00002000 00000080 00200000 4001b000 0400800a 00800000 00000000 00089008 00800000 00000000 00402000 00000201 00000020 10040e30 07000000 08100018 00000400 00000000 00000000 10000020 00000200 00040001 00000000 00002200 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |