On Target RDRP_SARS2 0.21308017/CHEMBL4065616
For the given ligand DB09050, we have found in our database that, being scored 0.21308017, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| DB09050 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| Cn1c(N)c(NC(=O)NCCN)c[n+]1C/C4=C(C(=O)[O-])/N3C(=O)[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2nsc(N)n2)[C@H]3SC4 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 04400087 c2806858 a0534200 0c310f60 01090088 98002000 c22c032c 9022a50d 1338a581 9a07c2c1 012b968d 600df941 8e01f886 00ac2105 851f0087 004c405c 74e00d01 08c443c0 21c10018 0372272c c0008580 b9018f92 af9a7b01 16400018 45001202 2c400f24 40c54020 c40605d8 0c00100c e0463123 24087091 a3b383e8 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |