On Target PR_SARS 0.18819188/CHEMBL3105073
For the given ligand DB15305, we have found in our database that, being scored 0.18819188, the most similar ligand is CHEMBL3105073. Check out the elaboration below.
| DB15305 (Given Ligand) | CHEMBL3105073 (Similar Ligand) |
|---|---|
| Cc6cn5nc(c4cc(=O)n3cc(N2CCNC1(CC1)C2)ccc3n4)cc(C)c5n6 | S=C(NCc1cccnc1)SCc1cc(Cl)sc1Cl |
|
|
|
|
|
|
| 0000e002 40800808 e01851b0 1c040630 210c1064 08006036 14c00000 20080d00 06000100 110002f0 85218004 60000800 86008802 09d02000 00160841 020c260c 08268800 0280f00c 0c600000 c0660207 40180009 3c028020 31802863 8270491a 00140402 c0100000 38020420 100408e5 0842400c 00463400 40040c80 002046a0 | 10018012 00008008 10006d00 01100610 20149004 00404084 04024000 22001000 00000001 03404040 01200204 40200880 0200180c 000c0001 80001000 00040104 04000400 02000304 00200000 01040208 40100000 48008981 20880020 02400000 05040000 04000200 28000400 a0020404 03603100 00060000 00000011 81c30288 |