On Target NSP15_SARS 0.33898306/CHEMBL2441741
For the given ligand DB04825, we have found in our database that, being scored 0.33898306, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| DB04825 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| C[C@@H](Cc1ccccc1)NCCC(c2ccccc2)c3ccccc3 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000000 00000200 00100100 00010600 00000000 00000000 00000000 21000000 00000880 000808c0 08300000 40008000 00000002 00000000 00000000 00040000 00000000 02000000 00000000 00000201 00000100 18200000 00000000 81400010 00000000 a0000000 00000000 50000000 04000080 0006000a 00000000 00002600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |