On Target PLP_SARS 0.28025478/CHEMBL213054
For the given ligand DB01211, we have found in our database that, being scored 0.28025478, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| DB01211 (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC[C@H]3OC(=O)[C@@H](C)[C@H](O[C@H]1C[C@](C)(OC)[C@H](O)[C@@H](C)O1)[C@H](C)[C@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@@H]2O)[C@](C)(OC)C[C@H](C)C(=O)[C@@H](C)[C@@H](O)[C@]3(C)O | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00050040 01000000 00100500 00810700 803c00c0 00200000 00002800 08000040 00202000 010000a0 00200000 40009000 14008028 02880000 00000000 002a9008 00a20000 00000100 11c0a000 00000001 00100020 10000a00 07000080 08000010 00000400 00000000 00000000 34000020 00000200 0004000a 00e20000 00000200 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |