On Target PLP_SARS 0.34108528/CHEMBL213054
For the given ligand DB12839, we have found in our database that, being scored 0.34108528, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| DB12839 (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| COCCOCCCCCC(=O)NCCCC[C@H](N)C(=O)O | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00010000 01001000 00100000 00010500 00080000 00000000 00000000 20000040 00002000 00000080 00200000 4001b000 0400800a 00800000 00000000 00089008 00800000 00000000 00402000 00000201 00000020 10040e30 07000000 08100018 00000400 00000000 00000000 10000020 00000200 00040001 00000000 00002200 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |